C25H27N5O4 — CID 10276408
3-[[2-[4-(pyridin-2-ylamino)butanoylamino]acetyl]amino]-3-(4-pyridin-4-ylphenyl)propanoic acid (PubChem CID 10276408) has the molecular formula C25H27N5O4 and a molecular weight of 461.52 g/mol. Its IUPAC name is 3-[[2-[4-(pyridin-2-ylamino)butanoylamino]acetyl]amino]-3-(4-pyridin-4-ylphenyl)propanoic acid.
| Compound Name | 3-[[2-[4-(pyridin-2-ylamino)butanoylamino]acetyl]amino]-3-(4-pyridin-4-ylphenyl)propanoic acid |
|---|---|
| PubChem CID | 10276408 |
| Molecular Formula | C25H27N5O4 |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.21 |
| IUPAC Name | 3-[[2-[4-(pyridin-2-ylamino)butanoylamino]acetyl]amino]-3-(4-pyridin-4-ylphenyl)propanoic acid |
| SMILES | O=C(O)CC(NC(=O)CNC(=O)CCCNc1ccccn1)c1ccc(-c2ccncc2)cc1 |
| InChI | InChI=1S/C25H27N5O4/c31-23(5-3-13-28-22-4-1-2-12-27-22)29-17-24(32)30-21(16-25(33)34)20-8-6-18(7-9-20)19-10-14-26-15-11-19/h1-2,4,6-12,14-15,21H,3,5,13,16-17H2,(H,27,28)(H,29,31)(H,30,32)(H,33,34) |
| InChIKey | NOMJVGRTDFTZMV-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 133.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|