C29H33N5O5 — CID 10119305
3-[[(2S)-5-amino-5-oxo-2-[4-(pyridin-2-ylamino)butanoylamino]pentanoyl]amino]-3-(4-phenylphenyl)propanoic acid (PubChem CID 10119305) has the molecular formula C29H33N5O5 and a molecular weight of 531.61 g/mol. Its IUPAC name is 3-[[(2S)-5-amino-5-oxo-2-[4-(pyridin-2-ylamino)butanoylamino]pentanoyl]amino]-3-(4-phenylphenyl)propanoic acid.
| Compound Name | 3-[[(2S)-5-amino-5-oxo-2-[4-(pyridin-2-ylamino)butanoylamino]pentanoyl]amino]-3-(4-phenylphenyl)propanoic acid |
|---|---|
| PubChem CID | 10119305 |
| Molecular Formula | C29H33N5O5 |
| Molecular Weight | 531.61 g/mol |
| Exact Mass | 531.25 |
| IUPAC Name | 3-[[(2S)-5-amino-5-oxo-2-[4-(pyridin-2-ylamino)butanoylamino]pentanoyl]amino]-3-(4-phenylphenyl)propanoic acid |
| SMILES | NC(=O)CC[C@H](NC(=O)CCCNc1ccccn1)C(=O)NC(CC(=O)O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C29H33N5O5/c30-25(35)16-15-23(33-27(36)10-6-18-32-26-9-4-5-17-31-26)29(39)34-24(19-28(37)38)22-13-11-21(12-14-22)20-7-2-1-3-8-20/h1-5,7-9,11-14,17,23-24H,6,10,15-16,18-19H2,(H2,30,35)(H,31,32)(H,33,36)(H,34,39)(H,37,38)/t23-,24?/m0/s1 |
| InChIKey | ARAXKGCCMWKXJQ-UXMRNZNESA-N |
| XLogP | 3.02 |
| TPSA | 163.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.61 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|