C30H36N4O4S — CID 10280769
3-[[(2R)-4-methylsulfanyl-2-[5-(pyridin-2-ylamino)pentanoylamino]butanoyl]amino]-3-(4-phenylphenyl)propanoic acid (PubChem CID 10280769) has the molecular formula C30H36N4O4S and a molecular weight of 548.71 g/mol. Its IUPAC name is 3-[[(2R)-4-methylsulfanyl-2-[5-(pyridin-2-ylamino)pentanoylamino]butanoyl]amino]-3-(4-phenylphenyl)propanoic acid.
| Compound Name | 3-[[(2R)-4-methylsulfanyl-2-[5-(pyridin-2-ylamino)pentanoylamino]butanoyl]amino]-3-(4-phenylphenyl)propanoic acid |
|---|---|
| PubChem CID | 10280769 |
| Molecular Formula | C30H36N4O4S |
| Molecular Weight | 548.71 g/mol |
| Exact Mass | 548.25 |
| IUPAC Name | 3-[[(2R)-4-methylsulfanyl-2-[5-(pyridin-2-ylamino)pentanoylamino]butanoyl]amino]-3-(4-phenylphenyl)propanoic acid |
| SMILES | CSCC[C@@H](NC(=O)CCCCNc1ccccn1)C(=O)NC(CC(=O)O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C30H36N4O4S/c1-39-20-17-25(33-28(35)12-6-8-19-32-27-11-5-7-18-31-27)30(38)34-26(21-29(36)37)24-15-13-23(14-16-24)22-9-3-2-4-10-22/h2-5,7,9-11,13-16,18,25-26H,6,8,12,17,19-21H2,1H3,(H,31,32)(H,33,35)(H,34,38)(H,36,37)/t25-,26?/m1/s1 |
| InChIKey | CKXRJHLIUKWLAV-DCWQJPKNSA-N |
| XLogP | 4.90 |
| TPSA | 120.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.71 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|