C32H37F3N4O6 — CID 69027561
3-(4-phenylphenyl)-3-[[(2S)-2-[4-(pyridin-2-ylamino)butanoylamino]hexanoyl]amino]propanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 69027561) has the molecular formula C32H37F3N4O6 and a molecular weight of 630.66 g/mol. Its IUPAC name is 3-(4-phenylphenyl)-3-[[(2S)-2-[4-(pyridin-2-ylamino)butanoylamino]hexanoyl]amino]propanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 3-(4-phenylphenyl)-3-[[(2S)-2-[4-(pyridin-2-ylamino)butanoylamino]hexanoyl]amino]propanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 69027561 |
| Molecular Formula | C32H37F3N4O6 |
| Molecular Weight | 630.66 g/mol |
| Exact Mass | 630.27 |
| IUPAC Name | 3-(4-phenylphenyl)-3-[[(2S)-2-[4-(pyridin-2-ylamino)butanoylamino]hexanoyl]amino]propanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | CCCC[C@H](NC(=O)CCCNc1ccccn1)C(=O)NC(CC(=O)O)c1ccc(-c2ccccc2)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C30H36N4O4.C2HF3O2/c1-2-3-12-25(33-28(35)14-9-20-32-27-13-7-8-19-31-27)30(38)34-26(21-29(36)37)24-17-15-23(16-18-24)22-10-5-4-6-11-22;3-2(4,5)1(6)7/h4-8,10-11,13,15-19,25-26H,2-3,9,12,14,20-21H2,1H3,(H,31,32)(H,33,35)(H,34,38)(H,36,37);(H,6,7)/t25-,26?;/m0./s1 |
| InChIKey | MDJUSAZBZVATRN-XZTCEYQHSA-N |
| XLogP | 5.58 |
| TPSA | 157.72 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.66 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|