C29H34N4O5 — CID 69029244
3-[[(2R)-4-hydroxy-2-[5-(pyridin-2-ylamino)pentanoylamino]butanoyl]amino]-3-(4-phenylphenyl)propanoic acid (PubChem CID 69029244) has the molecular formula C29H34N4O5 and a molecular weight of 518.61 g/mol. Its IUPAC name is 3-[[(2R)-4-hydroxy-2-[5-(pyridin-2-ylamino)pentanoylamino]butanoyl]amino]-3-(4-phenylphenyl)propanoic acid.
| Compound Name | 3-[[(2R)-4-hydroxy-2-[5-(pyridin-2-ylamino)pentanoylamino]butanoyl]amino]-3-(4-phenylphenyl)propanoic acid |
|---|---|
| PubChem CID | 69029244 |
| Molecular Formula | C29H34N4O5 |
| Molecular Weight | 518.61 g/mol |
| Exact Mass | 518.25 |
| IUPAC Name | 3-[[(2R)-4-hydroxy-2-[5-(pyridin-2-ylamino)pentanoylamino]butanoyl]amino]-3-(4-phenylphenyl)propanoic acid |
| SMILES | O=C(O)CC(NC(=O)[C@@H](CCO)NC(=O)CCCCNc1ccccn1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C29H34N4O5/c34-19-16-24(32-27(35)11-5-7-18-31-26-10-4-6-17-30-26)29(38)33-25(20-28(36)37)23-14-12-22(13-15-23)21-8-2-1-3-9-21/h1-4,6,8-10,12-15,17,24-25,34H,5,7,11,16,18-20H2,(H,30,31)(H,32,35)(H,33,38)(H,36,37)/t24-,25?/m1/s1 |
| InChIKey | KZKUJOPZSWGYCY-IKOFQBKESA-N |
| XLogP | 3.53 |
| TPSA | 140.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.61 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|