C41H42N4O4S — CID 12052646
3-[[(2S)-3-benzhydrylsulfanyl-2-[5-(pyridin-2-ylamino)pentanoylamino]propanoyl]amino]-3-(4-phenylphenyl)propanoic acid (PubChem CID 12052646) has the molecular formula C41H42N4O4S and a molecular weight of 686.88 g/mol. Its IUPAC name is 3-[[(2S)-3-benzhydrylsulfanyl-2-[5-(pyridin-2-ylamino)pentanoylamino]propanoyl]amino]-3-(4-phenylphenyl)propanoic acid.
| Compound Name | 3-[[(2S)-3-benzhydrylsulfanyl-2-[5-(pyridin-2-ylamino)pentanoylamino]propanoyl]amino]-3-(4-phenylphenyl)propanoic acid |
|---|---|
| PubChem CID | 12052646 |
| Molecular Formula | C41H42N4O4S |
| Molecular Weight | 686.88 g/mol |
| Exact Mass | 686.29 |
| IUPAC Name | 3-[[(2S)-3-benzhydrylsulfanyl-2-[5-(pyridin-2-ylamino)pentanoylamino]propanoyl]amino]-3-(4-phenylphenyl)propanoic acid |
| SMILES | O=C(O)CC(NC(=O)[C@@H](CSC(c1ccccc1)c1ccccc1)NC(=O)CCCCNc1ccccn1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C41H42N4O4S/c46-38(21-11-13-27-43-37-20-10-12-26-42-37)44-36(29-50-40(33-16-6-2-7-17-33)34-18-8-3-9-19-34)41(49)45-35(28-39(47)48)32-24-22-31(23-25-32)30-14-4-1-5-15-30/h1-10,12,14-20,22-26,35-36,40H,11,13,21,27-29H2,(H,42,43)(H,44,46)(H,45,49)(H,47,48)/t35?,36-/m1/s1 |
| InChIKey | NEFSOHJSDPAWSQ-BEBVUIBBSA-N |
| XLogP | 7.67 |
| TPSA | 120.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.88 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|