C35H38N4O5 — CID 12052654
3-[[(2S)-3-phenylmethoxy-2-[5-(pyridin-2-ylamino)pentanoylamino]propanoyl]amino]-3-(4-phenylphenyl)propanoic acid (PubChem CID 12052654) has the molecular formula C35H38N4O5 and a molecular weight of 594.71 g/mol. Its IUPAC name is 3-[[(2S)-3-phenylmethoxy-2-[5-(pyridin-2-ylamino)pentanoylamino]propanoyl]amino]-3-(4-phenylphenyl)propanoic acid.
| Compound Name | 3-[[(2S)-3-phenylmethoxy-2-[5-(pyridin-2-ylamino)pentanoylamino]propanoyl]amino]-3-(4-phenylphenyl)propanoic acid |
|---|---|
| PubChem CID | 12052654 |
| Molecular Formula | C35H38N4O5 |
| Molecular Weight | 594.71 g/mol |
| Exact Mass | 594.28 |
| IUPAC Name | 3-[[(2S)-3-phenylmethoxy-2-[5-(pyridin-2-ylamino)pentanoylamino]propanoyl]amino]-3-(4-phenylphenyl)propanoic acid |
| SMILES | O=C(O)CC(NC(=O)[C@H](COCc1ccccc1)NC(=O)CCCCNc1ccccn1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C35H38N4O5/c40-33(16-8-10-22-37-32-15-7-9-21-36-32)38-31(25-44-24-26-11-3-1-4-12-26)35(43)39-30(23-34(41)42)29-19-17-28(18-20-29)27-13-5-2-6-14-27/h1-7,9,11-15,17-21,30-31H,8,10,16,22-25H2,(H,36,37)(H,38,40)(H,39,43)(H,41,42)/t30?,31-/m0/s1 |
| InChIKey | JWHMHICZNXMROC-FLDQDSGZSA-N |
| XLogP | 5.36 |
| TPSA | 129.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.71 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|