C30H36N4O4 — CID 10229602
3-(4-phenylphenyl)-3-[[(2S)-2-[5-(pyridin-2-ylamino)pentanoylamino]pentanoyl]amino]propanoic acid (PubChem CID 10229602) has the molecular formula C30H36N4O4 and a molecular weight of 516.64 g/mol. Its IUPAC name is 3-(4-phenylphenyl)-3-[[(2S)-2-[5-(pyridin-2-ylamino)pentanoylamino]pentanoyl]amino]propanoic acid.
| Compound Name | 3-(4-phenylphenyl)-3-[[(2S)-2-[5-(pyridin-2-ylamino)pentanoylamino]pentanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 10229602 |
| Molecular Formula | C30H36N4O4 |
| Molecular Weight | 516.64 g/mol |
| Exact Mass | 516.27 |
| IUPAC Name | 3-(4-phenylphenyl)-3-[[(2S)-2-[5-(pyridin-2-ylamino)pentanoylamino]pentanoyl]amino]propanoic acid |
| SMILES | CCC[C@H](NC(=O)CCCCNc1ccccn1)C(=O)NC(CC(=O)O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C30H36N4O4/c1-2-10-25(33-28(35)14-7-9-20-32-27-13-6-8-19-31-27)30(38)34-26(21-29(36)37)24-17-15-23(16-18-24)22-11-4-3-5-12-22/h3-6,8,11-13,15-19,25-26H,2,7,9-10,14,20-21H2,1H3,(H,31,32)(H,33,35)(H,34,38)(H,36,37)/t25-,26?/m0/s1 |
| InChIKey | ZMDCJXOUGZUCBC-PMCHYTPCSA-N |
| XLogP | 4.95 |
| TPSA | 120.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.64 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|