C28H32N4O5 — CID 10185588
3-[[(2R)-3-hydroxy-2-[5-(pyridin-2-ylamino)pentanoylamino]propanoyl]amino]-3-(4-phenylphenyl)propanoic acid (PubChem CID 10185588) has the molecular formula C28H32N4O5 and a molecular weight of 504.59 g/mol. Its IUPAC name is 3-[[(2R)-3-hydroxy-2-[5-(pyridin-2-ylamino)pentanoylamino]propanoyl]amino]-3-(4-phenylphenyl)propanoic acid.
| Compound Name | 3-[[(2R)-3-hydroxy-2-[5-(pyridin-2-ylamino)pentanoylamino]propanoyl]amino]-3-(4-phenylphenyl)propanoic acid |
|---|---|
| PubChem CID | 10185588 |
| Molecular Formula | C28H32N4O5 |
| Molecular Weight | 504.59 g/mol |
| Exact Mass | 504.24 |
| IUPAC Name | 3-[[(2R)-3-hydroxy-2-[5-(pyridin-2-ylamino)pentanoylamino]propanoyl]amino]-3-(4-phenylphenyl)propanoic acid |
| SMILES | O=C(O)CC(NC(=O)[C@@H](CO)NC(=O)CCCCNc1ccccn1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C28H32N4O5/c33-19-24(31-26(34)11-5-7-17-30-25-10-4-6-16-29-25)28(37)32-23(18-27(35)36)22-14-12-21(13-15-22)20-8-2-1-3-9-20/h1-4,6,8-10,12-16,23-24,33H,5,7,11,17-19H2,(H,29,30)(H,31,34)(H,32,37)(H,35,36)/t23?,24-/m1/s1 |
| InChIKey | FSXOYTMPYWLBLF-XMMISQBUSA-N |
| XLogP | 3.14 |
| TPSA | 140.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.59 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|