C31H31F3N4O7 — CID 87664110
(4R)-5-oxo-5-[[3-oxo-1-(4-phenylphenyl)-3-(2,2,2-trifluoroacetyl)oxypropyl]amino]-4-[4-(pyridin-2-ylamino)butanoylamino]pentanoic acid (PubChem CID 87664110) has the molecular formula C31H31F3N4O7 and a molecular weight of 628.60 g/mol. Its IUPAC name is (4R)-5-oxo-5-[[3-oxo-1-(4-phenylphenyl)-3-(2,2,2-trifluoroacetyl)oxypropyl]amino]-4-[4-(pyridin-2-ylamino)butanoylamino]pentanoic acid.
| Compound Name | (4R)-5-oxo-5-[[3-oxo-1-(4-phenylphenyl)-3-(2,2,2-trifluoroacetyl)oxypropyl]amino]-4-[4-(pyridin-2-ylamino)butanoylamino]pentanoic acid |
|---|---|
| PubChem CID | 87664110 |
| Molecular Formula | C31H31F3N4O7 |
| Molecular Weight | 628.60 g/mol |
| Exact Mass | 628.21 |
| IUPAC Name | (4R)-5-oxo-5-[[3-oxo-1-(4-phenylphenyl)-3-(2,2,2-trifluoroacetyl)oxypropyl]amino]-4-[4-(pyridin-2-ylamino)butanoylamino]pentanoic acid |
| SMILES | O=C(O)CC[C@@H](NC(=O)CCCNc1ccccn1)C(=O)NC(CC(=O)OC(=O)C(F)(F)F)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C31H31F3N4O7/c32-31(33,34)30(44)45-28(42)19-24(22-13-11-21(12-14-22)20-7-2-1-3-8-20)38-29(43)23(15-16-27(40)41)37-26(39)10-6-18-36-25-9-4-5-17-35-25/h1-5,7-9,11-14,17,23-24H,6,10,15-16,18-19H2,(H,35,36)(H,37,39)(H,38,43)(H,40,41)/t23-,24?/m1/s1 |
| InChIKey | MDUGFDREODCUFX-MIHMCVIASA-N |
| XLogP | 4.17 |
| TPSA | 163.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.60 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|