C37H37F3N4O5S — CID 87663480
(2,2,2-trifluoroacetyl) 3-[[(2S)-3-benzylsulfanyl-2-[5-(pyridin-2-ylamino)pentanoylamino]propanoyl]amino]-3-(4-phenylphenyl)propanoate (PubChem CID 87663480) has the molecular formula C37H37F3N4O5S and a molecular weight of 706.79 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) 3-[[(2S)-3-benzylsulfanyl-2-[5-(pyridin-2-ylamino)pentanoylamino]propanoyl]amino]-3-(4-phenylphenyl)propanoate.
| Compound Name | (2,2,2-trifluoroacetyl) 3-[[(2S)-3-benzylsulfanyl-2-[5-(pyridin-2-ylamino)pentanoylamino]propanoyl]amino]-3-(4-phenylphenyl)propanoate |
|---|---|
| PubChem CID | 87663480 |
| Molecular Formula | C37H37F3N4O5S |
| Molecular Weight | 706.79 g/mol |
| Exact Mass | 706.24 |
| IUPAC Name | (2,2,2-trifluoroacetyl) 3-[[(2S)-3-benzylsulfanyl-2-[5-(pyridin-2-ylamino)pentanoylamino]propanoyl]amino]-3-(4-phenylphenyl)propanoate |
| SMILES | O=C(CCCCNc1ccccn1)N[C@H](CSCc1ccccc1)C(=O)NC(CC(=O)OC(=O)C(F)(F)F)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C37H37F3N4O5S/c38-37(39,40)36(48)49-34(46)23-30(29-19-17-28(18-20-29)27-13-5-2-6-14-27)44-35(47)31(25-50-24-26-11-3-1-4-12-26)43-33(45)16-8-10-22-42-32-15-7-9-21-41-32/h1-7,9,11-15,17-21,30-31H,8,10,16,22-25H2,(H,41,42)(H,43,45)(H,44,47)/t30?,31-/m1/s1 |
| InChIKey | UZYOVWHVIQZLAY-NLIBRCFJSA-N |
| XLogP | 6.63 |
| TPSA | 126.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.79 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|