C36H35F3N4O5 — CID 87664958
(2,2,2-trifluoroacetyl) 3-(4-phenylphenyl)-3-[[(2R)-3-phenyl-2-[5-(pyridin-2-ylamino)pentanoylamino]propanoyl]amino]propanoate (PubChem CID 87664958) has the molecular formula C36H35F3N4O5 and a molecular weight of 660.69 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) 3-(4-phenylphenyl)-3-[[(2R)-3-phenyl-2-[5-(pyridin-2-ylamino)pentanoylamino]propanoyl]amino]propanoate.
| Compound Name | (2,2,2-trifluoroacetyl) 3-(4-phenylphenyl)-3-[[(2R)-3-phenyl-2-[5-(pyridin-2-ylamino)pentanoylamino]propanoyl]amino]propanoate |
|---|---|
| PubChem CID | 87664958 |
| Molecular Formula | C36H35F3N4O5 |
| Molecular Weight | 660.69 g/mol |
| Exact Mass | 660.26 |
| IUPAC Name | (2,2,2-trifluoroacetyl) 3-(4-phenylphenyl)-3-[[(2R)-3-phenyl-2-[5-(pyridin-2-ylamino)pentanoylamino]propanoyl]amino]propanoate |
| SMILES | O=C(CCCCNc1ccccn1)N[C@H](Cc1ccccc1)C(=O)NC(CC(=O)OC(=O)C(F)(F)F)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C36H35F3N4O5/c37-36(38,39)35(47)48-33(45)24-29(28-19-17-27(18-20-28)26-13-5-2-6-14-26)43-34(46)30(23-25-11-3-1-4-12-25)42-32(44)16-8-10-22-41-31-15-7-9-21-40-31/h1-7,9,11-15,17-21,29-30H,8,10,16,22-24H2,(H,40,41)(H,42,44)(H,43,46)/t29?,30-/m1/s1 |
| InChIKey | ZHRIZSKPKNOZEI-BDCODIICSA-N |
| XLogP | 5.94 |
| TPSA | 126.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.69 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|