C35H41F3N6O6 — CID 87664103
(2,2,2-trifluoroacetyl) 3-[[(2S)-6-(carbamoylamino)-2-[6-(pyridin-2-ylamino)hexanoylamino]hexanoyl]amino]-3-(4-phenylphenyl)propanoate (PubChem CID 87664103) has the molecular formula C35H41F3N6O6 and a molecular weight of 698.74 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) 3-[[(2S)-6-(carbamoylamino)-2-[6-(pyridin-2-ylamino)hexanoylamino]hexanoyl]amino]-3-(4-phenylphenyl)propanoate.
| Compound Name | (2,2,2-trifluoroacetyl) 3-[[(2S)-6-(carbamoylamino)-2-[6-(pyridin-2-ylamino)hexanoylamino]hexanoyl]amino]-3-(4-phenylphenyl)propanoate |
|---|---|
| PubChem CID | 87664103 |
| Molecular Formula | C35H41F3N6O6 |
| Molecular Weight | 698.74 g/mol |
| Exact Mass | 698.30 |
| IUPAC Name | (2,2,2-trifluoroacetyl) 3-[[(2S)-6-(carbamoylamino)-2-[6-(pyridin-2-ylamino)hexanoylamino]hexanoyl]amino]-3-(4-phenylphenyl)propanoate |
| SMILES | NC(=O)NCCCC[C@H](NC(=O)CCCCCNc1ccccn1)C(=O)NC(CC(=O)OC(=O)C(F)(F)F)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C35H41F3N6O6/c36-35(37,38)33(48)50-31(46)23-28(26-18-16-25(17-19-26)24-11-3-1-4-12-24)44-32(47)27(13-6-9-22-42-34(39)49)43-30(45)15-5-2-8-20-40-29-14-7-10-21-41-29/h1,3-4,7,10-12,14,16-19,21,27-28H,2,5-6,8-9,13,15,20,22-23H2,(H,40,41)(H,43,45)(H,44,47)(H3,39,42,49)/t27-,28?/m0/s1 |
| InChIKey | GGYUFXKJPNGVHE-MBMZGMDYSA-N |
| XLogP | 4.92 |
| TPSA | 181.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.74 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|