C33H37F3N4O6S — CID 87664672
(2,2,2-trifluoroacetyl) 3-[[(2S)-4-methylsulfinyl-2-[6-(pyridin-2-ylamino)hexanoylamino]butanoyl]amino]-3-(4-phenylphenyl)propanoate (PubChem CID 87664672) has the molecular formula C33H37F3N4O6S and a molecular weight of 674.74 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) 3-[[(2S)-4-methylsulfinyl-2-[6-(pyridin-2-ylamino)hexanoylamino]butanoyl]amino]-3-(4-phenylphenyl)propanoate.
| Compound Name | (2,2,2-trifluoroacetyl) 3-[[(2S)-4-methylsulfinyl-2-[6-(pyridin-2-ylamino)hexanoylamino]butanoyl]amino]-3-(4-phenylphenyl)propanoate |
|---|---|
| PubChem CID | 87664672 |
| Molecular Formula | C33H37F3N4O6S |
| Molecular Weight | 674.74 g/mol |
| Exact Mass | 674.24 |
| IUPAC Name | (2,2,2-trifluoroacetyl) 3-[[(2S)-4-methylsulfinyl-2-[6-(pyridin-2-ylamino)hexanoylamino]butanoyl]amino]-3-(4-phenylphenyl)propanoate |
| SMILES | CS(=O)CC[C@H](NC(=O)CCCCCNc1ccccn1)C(=O)NC(CC(=O)OC(=O)C(F)(F)F)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C33H37F3N4O6S/c1-47(45)21-18-26(39-29(41)13-6-3-8-19-37-28-12-7-9-20-38-28)31(43)40-27(22-30(42)46-32(44)33(34,35)36)25-16-14-24(15-17-25)23-10-4-2-5-11-23/h2,4-5,7,9-12,14-17,20,26-27H,3,6,8,13,18-19,21-22H2,1H3,(H,37,38)(H,39,41)(H,40,43)/t26-,27?,47?/m0/s1 |
| InChIKey | MZQMXBJQOLWESH-USYHZMEQSA-N |
| XLogP | 4.85 |
| TPSA | 143.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.74 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|