C32H35F3N4O5 — CID 87664132
(2,2,2-trifluoroacetyl) 3-(4-phenylphenyl)-3-[[(2R)-2-[4-(pyridin-2-ylamino)butanoylamino]hexanoyl]amino]propanoate (PubChem CID 87664132) has the molecular formula C32H35F3N4O5 and a molecular weight of 612.65 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) 3-(4-phenylphenyl)-3-[[(2R)-2-[4-(pyridin-2-ylamino)butanoylamino]hexanoyl]amino]propanoate.
| Compound Name | (2,2,2-trifluoroacetyl) 3-(4-phenylphenyl)-3-[[(2R)-2-[4-(pyridin-2-ylamino)butanoylamino]hexanoyl]amino]propanoate |
|---|---|
| PubChem CID | 87664132 |
| Molecular Formula | C32H35F3N4O5 |
| Molecular Weight | 612.65 g/mol |
| Exact Mass | 612.26 |
| IUPAC Name | (2,2,2-trifluoroacetyl) 3-(4-phenylphenyl)-3-[[(2R)-2-[4-(pyridin-2-ylamino)butanoylamino]hexanoyl]amino]propanoate |
| SMILES | CCCC[C@@H](NC(=O)CCCNc1ccccn1)C(=O)NC(CC(=O)OC(=O)C(F)(F)F)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C32H35F3N4O5/c1-2-3-12-25(38-28(40)14-9-20-37-27-13-7-8-19-36-27)30(42)39-26(21-29(41)44-31(43)32(33,34)35)24-17-15-23(16-18-24)22-10-5-4-6-11-22/h4-8,10-11,13,15-19,25-26H,2-3,9,12,14,20-21H2,1H3,(H,36,37)(H,38,40)(H,39,42)/t25-,26?/m1/s1 |
| InChIKey | XKENDODUEMSDRK-DCWQJPKNSA-N |
| XLogP | 5.50 |
| TPSA | 126.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.65 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|