C33H37F3N4O5 — CID 87664010
(2,2,2-trifluoroacetyl) 3-[[(2S)-3,3-dimethyl-2-[5-(pyridin-2-ylamino)pentanoylamino]butanoyl]amino]-3-(4-phenylphenyl)propanoate (PubChem CID 87664010) has the molecular formula C33H37F3N4O5 and a molecular weight of 626.68 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) 3-[[(2S)-3,3-dimethyl-2-[5-(pyridin-2-ylamino)pentanoylamino]butanoyl]amino]-3-(4-phenylphenyl)propanoate.
| Compound Name | (2,2,2-trifluoroacetyl) 3-[[(2S)-3,3-dimethyl-2-[5-(pyridin-2-ylamino)pentanoylamino]butanoyl]amino]-3-(4-phenylphenyl)propanoate |
|---|---|
| PubChem CID | 87664010 |
| Molecular Formula | C33H37F3N4O5 |
| Molecular Weight | 626.68 g/mol |
| Exact Mass | 626.27 |
| IUPAC Name | (2,2,2-trifluoroacetyl) 3-[[(2S)-3,3-dimethyl-2-[5-(pyridin-2-ylamino)pentanoylamino]butanoyl]amino]-3-(4-phenylphenyl)propanoate |
| SMILES | CC(C)(C)[C@H](NC(=O)CCCCNc1ccccn1)C(=O)NC(CC(=O)OC(=O)C(F)(F)F)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C33H37F3N4O5/c1-32(2,3)29(40-27(41)14-8-10-20-38-26-13-7-9-19-37-26)30(43)39-25(21-28(42)45-31(44)33(34,35)36)24-17-15-23(16-18-24)22-11-5-4-6-12-22/h4-7,9,11-13,15-19,25,29H,8,10,14,20-21H2,1-3H3,(H,37,38)(H,39,43)(H,40,41)/t25?,29-/m1/s1 |
| InChIKey | VNBMSQQOQBOHSE-SNSSHHSLSA-N |
| XLogP | 5.74 |
| TPSA | 126.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.68 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|