C34H31F3N4O5 — CID 87663122
(2,2,2-trifluoroacetyl) 3-(4-phenylphenyl)-3-[[(2R)-2-phenyl-2-[4-(pyridin-2-ylamino)butanoylamino]acetyl]amino]propanoate (PubChem CID 87663122) has the molecular formula C34H31F3N4O5 and a molecular weight of 632.64 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) 3-(4-phenylphenyl)-3-[[(2R)-2-phenyl-2-[4-(pyridin-2-ylamino)butanoylamino]acetyl]amino]propanoate.
| Compound Name | (2,2,2-trifluoroacetyl) 3-(4-phenylphenyl)-3-[[(2R)-2-phenyl-2-[4-(pyridin-2-ylamino)butanoylamino]acetyl]amino]propanoate |
|---|---|
| PubChem CID | 87663122 |
| Molecular Formula | C34H31F3N4O5 |
| Molecular Weight | 632.64 g/mol |
| Exact Mass | 632.22 |
| IUPAC Name | (2,2,2-trifluoroacetyl) 3-(4-phenylphenyl)-3-[[(2R)-2-phenyl-2-[4-(pyridin-2-ylamino)butanoylamino]acetyl]amino]propanoate |
| SMILES | O=C(CCCNc1ccccn1)N[C@@H](C(=O)NC(CC(=O)OC(=O)C(F)(F)F)c1ccc(-c2ccccc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C34H31F3N4O5/c35-34(36,37)33(45)46-30(43)22-27(25-18-16-24(17-19-25)23-10-3-1-4-11-23)40-32(44)31(26-12-5-2-6-13-26)41-29(42)15-9-21-39-28-14-7-8-20-38-28/h1-8,10-14,16-20,27,31H,9,15,21-22H2,(H,38,39)(H,40,44)(H,41,42)/t27?,31-/m1/s1 |
| InChIKey | IJGBVZVWYKMWOL-SLJLDQLWSA-N |
| XLogP | 5.68 |
| TPSA | 126.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.64 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|