C31H32N4NaO4 — CID 70012491
CID 70012491 (PubChem CID 70012491) has the molecular formula C31H32N4NaO4 and a molecular weight of 547.61 g/mol.
| Compound Name | CID 70012491 |
|---|---|
| PubChem CID | 70012491 |
| Molecular Formula | C31H32N4NaO4 |
| Molecular Weight | 547.61 g/mol |
| Exact Mass | 547.23 |
| IUPAC Name | — |
| SMILES | Cc1ccnc(NCCCC(=O)NCC(=O)NC(CC(=O)O)c2ccc(-c3ccc4ccccc4c3)cc2)c1.[Na] |
| InChI | InChI=1S/C31H32N4O4.Na/c1-21-14-16-33-28(17-21)32-15-4-7-29(36)34-20-30(37)35-27(19-31(38)39)24-11-8-23(9-12-24)26-13-10-22-5-2-3-6-25(22)18-26;/h2-3,5-6,8-14,16-18,27H,4,7,15,19-20H2,1H3,(H,32,33)(H,34,36)(H,35,37)(H,38,39); |
| InChIKey | GVAMQYOYJOIGFS-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 120.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.61 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|