C21H25N5O6 — CID 18518066
3-[[2-[4-[(4-methyl-2-pyridinyl)amino]butanoylamino]acetyl]amino]-3-(4-nitrophenyl)propanoic acid (PubChem CID 18518066) has the molecular formula C21H25N5O6 and a molecular weight of 443.46 g/mol. Its IUPAC name is 3-[[2-[4-[(4-methyl-2-pyridinyl)amino]butanoylamino]acetyl]amino]-3-(4-nitrophenyl)propanoic acid.
| Compound Name | 3-[[2-[4-[(4-methyl-2-pyridinyl)amino]butanoylamino]acetyl]amino]-3-(4-nitrophenyl)propanoic acid |
|---|---|
| PubChem CID | 18518066 |
| Molecular Formula | C21H25N5O6 |
| Molecular Weight | 443.46 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | 3-[[2-[4-[(4-methyl-2-pyridinyl)amino]butanoylamino]acetyl]amino]-3-(4-nitrophenyl)propanoic acid |
| SMILES | Cc1ccnc(NCCCC(=O)NCC(=O)NC(CC(=O)O)c2ccc([N+](=O)[O-])cc2)c1 |
| InChI | InChI=1S/C21H25N5O6/c1-14-8-10-23-18(11-14)22-9-2-3-19(27)24-13-20(28)25-17(12-21(29)30)15-4-6-16(7-5-15)26(31)32/h4-8,10-11,17H,2-3,9,12-13H2,1H3,(H,22,23)(H,24,27)(H,25,28)(H,29,30) |
| InChIKey | RMWPANFPMFXYMJ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 163.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.46 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|