C32H33N5O5 — CID 170710602
(3S)-3-[4-(4-carbamoylnaphthalen-1-yl)phenyl]-3-[[2-[4-[(4-methyl-2-pyridinyl)amino]butanoylamino]acetyl]amino]propanoic acid (PubChem CID 170710602) has the molecular formula C32H33N5O5 and a molecular weight of 567.65 g/mol. Its IUPAC name is (3S)-3-[4-(4-carbamoylnaphthalen-1-yl)phenyl]-3-[[2-[4-[(4-methyl-2-pyridinyl)amino]butanoylamino]acetyl]amino]propanoic acid.
| Compound Name | (3S)-3-[4-(4-carbamoylnaphthalen-1-yl)phenyl]-3-[[2-[4-[(4-methyl-2-pyridinyl)amino]butanoylamino]acetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 170710602 |
| Molecular Formula | C32H33N5O5 |
| Molecular Weight | 567.65 g/mol |
| Exact Mass | 567.25 |
| IUPAC Name | (3S)-3-[4-(4-carbamoylnaphthalen-1-yl)phenyl]-3-[[2-[4-[(4-methyl-2-pyridinyl)amino]butanoylamino]acetyl]amino]propanoic acid |
| SMILES | Cc1ccnc(NCCCC(=O)NCC(=O)N[C@@H](CC(=O)O)c2ccc(-c3ccc(C(N)=O)c4ccccc34)cc2)c1 |
| InChI | InChI=1S/C32H33N5O5/c1-20-14-16-35-28(17-20)34-15-4-7-29(38)36-19-30(39)37-27(18-31(40)41)22-10-8-21(9-11-22)23-12-13-26(32(33)42)25-6-3-2-5-24(23)25/h2-3,5-6,8-14,16-17,27H,4,7,15,18-19H2,1H3,(H2,33,42)(H,34,35)(H,36,38)(H,37,39)(H,40,41)/t27-/m0/s1 |
| InChIKey | QAPYWDPWOVUCMF-MHZLTWQESA-N |
| XLogP | 3.95 |
| TPSA | 163.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.65 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|