C33H36N4O5 — CID 177248459
(3S)-3-[[2-[5-[(4-methoxy-2-pyridinyl)amino]pentanoylamino]acetyl]amino]-3-[4-(4-methylnaphthalen-1-yl)phenyl]propanoic acid (PubChem CID 177248459) has the molecular formula C33H36N4O5 and a molecular weight of 568.67 g/mol. Its IUPAC name is (3S)-3-[[2-[5-[(4-methoxy-2-pyridinyl)amino]pentanoylamino]acetyl]amino]-3-[4-(4-methylnaphthalen-1-yl)phenyl]propanoic acid.
| Compound Name | (3S)-3-[[2-[5-[(4-methoxy-2-pyridinyl)amino]pentanoylamino]acetyl]amino]-3-[4-(4-methylnaphthalen-1-yl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 177248459 |
| Molecular Formula | C33H36N4O5 |
| Molecular Weight | 568.67 g/mol |
| Exact Mass | 568.27 |
| IUPAC Name | (3S)-3-[[2-[5-[(4-methoxy-2-pyridinyl)amino]pentanoylamino]acetyl]amino]-3-[4-(4-methylnaphthalen-1-yl)phenyl]propanoic acid |
| SMILES | COc1ccnc(NCCCCC(=O)NCC(=O)N[C@@H](CC(=O)O)c2ccc(-c3ccc(C)c4ccccc34)cc2)c1 |
| InChI | InChI=1S/C33H36N4O5/c1-22-10-15-27(28-8-4-3-7-26(22)28)23-11-13-24(14-12-23)29(20-33(40)41)37-32(39)21-36-31(38)9-5-6-17-34-30-19-25(42-2)16-18-35-30/h3-4,7-8,10-16,18-19,29H,5-6,9,17,20-21H2,1-2H3,(H,34,35)(H,36,38)(H,37,39)(H,40,41)/t29-/m0/s1 |
| InChIKey | JRDJAAYGMQHMTD-LJAQVGFWSA-N |
| XLogP | 5.25 |
| TPSA | 129.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.67 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|