C42H54FN5O9 — CID 162756041
3-[[2-[5-[(4-fluoro-2-pyridinyl)amino]pentanoylamino]acetyl]amino]-3-[4-[4-[2-[2-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]naphthalen-1-yl]phenyl]propanoic acid (PubChem CID 162756041) has the molecular formula C42H54FN5O9 and a molecular weight of 791.92 g/mol. Its IUPAC name is 3-[[2-[5-[(4-fluoro-2-pyridinyl)amino]pentanoylamino]acetyl]amino]-3-[4-[4-[2-[2-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]naphthalen-1-yl]phenyl]propanoic acid.
| Compound Name | 3-[[2-[5-[(4-fluoro-2-pyridinyl)amino]pentanoylamino]acetyl]amino]-3-[4-[4-[2-[2-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]naphthalen-1-yl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 162756041 |
| Molecular Formula | C42H54FN5O9 |
| Molecular Weight | 791.92 g/mol |
| Exact Mass | 791.39 |
| IUPAC Name | 3-[[2-[5-[(4-fluoro-2-pyridinyl)amino]pentanoylamino]acetyl]amino]-3-[4-[4-[2-[2-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]naphthalen-1-yl]phenyl]propanoic acid |
| SMILES | CNCCOCCOCCOCCOCCOc1ccc(-c2ccc(C(CC(=O)O)NC(=O)CNC(=O)CCCCNc3cc(F)ccn3)cc2)c2ccccc12 |
| InChI | InChI=1S/C42H54FN5O9/c1-44-18-19-53-20-21-54-22-23-55-24-25-56-26-27-57-38-14-13-34(35-6-2-3-7-36(35)38)31-9-11-32(12-10-31)37(29-42(51)52)48-41(50)30-47-40(49)8-4-5-16-45-39-28-33(43)15-17-46-39/h2-3,6-7,9-15,17,28,37,44H,4-5,8,16,18-27,29-30H2,1H3,(H,45,46)(H,47,49)(H,48,50)(H,51,52) |
| InChIKey | CJTNRTQEBJYYNU-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 178.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.92 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|