C42H55N5O9 — CID 171529100
3-[4-[4-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]naphthalen-1-yl]phenyl]-3-[[2-[5-[(4-methyl-2-pyridinyl)amino]pentanoylamino]acetyl]amino]propanoic acid (PubChem CID 171529100) has the molecular formula C42H55N5O9 and a molecular weight of 773.93 g/mol. Its IUPAC name is 3-[4-[4-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]naphthalen-1-yl]phenyl]-3-[[2-[5-[(4-methyl-2-pyridinyl)amino]pentanoylamino]acetyl]amino]propanoic acid.
| Compound Name | 3-[4-[4-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]naphthalen-1-yl]phenyl]-3-[[2-[5-[(4-methyl-2-pyridinyl)amino]pentanoylamino]acetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 171529100 |
| Molecular Formula | C42H55N5O9 |
| Molecular Weight | 773.93 g/mol |
| Exact Mass | 773.40 |
| IUPAC Name | 3-[4-[4-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]naphthalen-1-yl]phenyl]-3-[[2-[5-[(4-methyl-2-pyridinyl)amino]pentanoylamino]acetyl]amino]propanoic acid |
| SMILES | Cc1ccnc(NCCCCC(=O)NCC(=O)NC(CC(=O)O)c2ccc(-c3ccc(OCCOCCOCCOCCOCCN)c4ccccc34)cc2)c1 |
| InChI | InChI=1S/C42H55N5O9/c1-31-15-18-45-39(28-31)44-17-5-4-8-40(48)46-30-41(49)47-37(29-42(50)51)33-11-9-32(10-12-33)34-13-14-38(36-7-3-2-6-35(34)36)56-27-26-55-25-24-54-23-22-53-21-20-52-19-16-43/h2-3,6-7,9-15,18,28,37H,4-5,8,16-17,19-27,29-30,43H2,1H3,(H,44,45)(H,46,48)(H,47,49)(H,50,51) |
| InChIKey | HWUVFMIXRAFUTJ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 192.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 773.93 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|