C31H32N4NaO4 — CID 70012267
CID 70012267 (PubChem CID 70012267) has the molecular formula C31H32N4NaO4 and a molecular weight of 547.61 g/mol.
| Compound Name | CID 70012267 |
|---|---|
| PubChem CID | 70012267 |
| Molecular Formula | C31H32N4NaO4 |
| Molecular Weight | 547.61 g/mol |
| Exact Mass | 547.23 |
| IUPAC Name | — |
| SMILES | O=C(O)CC(NC(=O)CNC(=O)CCCCNc1ccccn1)c1ccc(-c2cccc3ccccc23)cc1.[Na] |
| InChI | InChI=1S/C31H32N4O4.Na/c36-29(13-4-6-19-33-28-12-3-5-18-32-28)34-21-30(37)35-27(20-31(38)39)24-16-14-23(15-17-24)26-11-7-9-22-8-1-2-10-25(22)26;/h1-3,5,7-12,14-18,27H,4,6,13,19-21H2,(H,32,33)(H,34,36)(H,35,37)(H,38,39); |
| InChIKey | UMHNAZOJPSXKHY-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 120.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.61 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|