C31H32N4NaO5 — CID 70011382
CID 70011382 (PubChem CID 70011382) has the molecular formula C31H32N4NaO5 and a molecular weight of 563.61 g/mol.
| Compound Name | CID 70011382 |
|---|---|
| PubChem CID | 70011382 |
| Molecular Formula | C31H32N4NaO5 |
| Molecular Weight | 563.61 g/mol |
| Exact Mass | 563.23 |
| IUPAC Name | — |
| SMILES | Cc1ccnc(NCCCC(=O)NCC(=O)NC(CC(=O)O)c2ccc(-c3cccc4ccccc34)cc2O)c1.[Na] |
| InChI | InChI=1S/C31H32N4O5.Na/c1-20-13-15-33-28(16-20)32-14-5-10-29(37)34-19-30(38)35-26(18-31(39)40)25-12-11-22(17-27(25)36)24-9-4-7-21-6-2-3-8-23(21)24;/h2-4,6-9,11-13,15-17,26,36H,5,10,14,18-19H2,1H3,(H,32,33)(H,34,37)(H,35,38)(H,39,40); |
| InChIKey | UXIQLUUMXBSCLH-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 140.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.61 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|