C28H32N4O5 — CID 18518138
methyl 3-(3-hydroxy-4-phenylphenyl)-3-[[2-[4-[(4-methyl-2-pyridinyl)amino]butanoylamino]acetyl]amino]propanoate (PubChem CID 18518138) has the molecular formula C28H32N4O5 and a molecular weight of 504.59 g/mol. Its IUPAC name is methyl 3-(3-hydroxy-4-phenylphenyl)-3-[[2-[4-[(4-methyl-2-pyridinyl)amino]butanoylamino]acetyl]amino]propanoate.
| Compound Name | methyl 3-(3-hydroxy-4-phenylphenyl)-3-[[2-[4-[(4-methyl-2-pyridinyl)amino]butanoylamino]acetyl]amino]propanoate |
|---|---|
| PubChem CID | 18518138 |
| Molecular Formula | C28H32N4O5 |
| Molecular Weight | 504.59 g/mol |
| Exact Mass | 504.24 |
| IUPAC Name | methyl 3-(3-hydroxy-4-phenylphenyl)-3-[[2-[4-[(4-methyl-2-pyridinyl)amino]butanoylamino]acetyl]amino]propanoate |
| SMILES | COC(=O)CC(NC(=O)CNC(=O)CCCNc1cc(C)ccn1)c1ccc(-c2ccccc2)c(O)c1 |
| InChI | InChI=1S/C28H32N4O5/c1-19-12-14-30-25(15-19)29-13-6-9-26(34)31-18-27(35)32-23(17-28(36)37-2)21-10-11-22(24(33)16-21)20-7-4-3-5-8-20/h3-5,7-8,10-12,14-16,23,33H,6,9,13,17-18H2,1-2H3,(H,29,30)(H,31,34)(H,32,35) |
| InChIKey | FXVVWDUNHSBNHJ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 129.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.59 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|