C27H30N4NaO5 — CID 70012004
CID 70012004 (PubChem CID 70012004) has the molecular formula C27H30N4NaO5 and a molecular weight of 513.55 g/mol.
| Compound Name | CID 70012004 |
|---|---|
| PubChem CID | 70012004 |
| Molecular Formula | C27H30N4NaO5 |
| Molecular Weight | 513.55 g/mol |
| Exact Mass | 513.21 |
| IUPAC Name | — |
| SMILES | Cc1ccnc(NCCCC(=O)NCC(=O)NC(CC(=O)O)c2cccc(-c3ccccc3)c2O)c1.[Na] |
| InChI | InChI=1S/C27H30N4O5.Na/c1-18-12-14-29-23(15-18)28-13-6-11-24(32)30-17-25(33)31-22(16-26(34)35)21-10-5-9-20(27(21)36)19-7-3-2-4-8-19;/h2-5,7-10,12,14-15,22,36H,6,11,13,16-17H2,1H3,(H,28,29)(H,30,32)(H,31,33)(H,34,35); |
| InChIKey | HFETUJNCRQKBHG-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 140.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.55 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|