C21H30N4O4 — CID 142583454
(E,3S)-4-ethenyl-3-[[2-[4-[(4-methyl-2-pyridinyl)amino]butanoylamino]acetyl]amino]hept-4-enoic acid (PubChem CID 142583454) has the molecular formula C21H30N4O4 and a molecular weight of 402.50 g/mol. Its IUPAC name is (E,3S)-4-ethenyl-3-[[2-[4-[(4-methyl-2-pyridinyl)amino]butanoylamino]acetyl]amino]hept-4-enoic acid.
| Compound Name | (E,3S)-4-ethenyl-3-[[2-[4-[(4-methyl-2-pyridinyl)amino]butanoylamino]acetyl]amino]hept-4-enoic acid |
|---|---|
| PubChem CID | 142583454 |
| Molecular Formula | C21H30N4O4 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | (E,3S)-4-ethenyl-3-[[2-[4-[(4-methyl-2-pyridinyl)amino]butanoylamino]acetyl]amino]hept-4-enoic acid |
| SMILES | C=C/C(=C\CC)[C@H](CC(=O)O)NC(=O)CNC(=O)CCCNc1cc(C)ccn1 |
| InChI | InChI=1S/C21H30N4O4/c1-4-7-16(5-2)17(13-21(28)29)25-20(27)14-24-19(26)8-6-10-22-18-12-15(3)9-11-23-18/h5,7,9,11-12,17H,2,4,6,8,10,13-14H2,1,3H3,(H,22,23)(H,24,26)(H,25,27)(H,28,29)/b16-7+/t17-/m0/s1 |
| InChIKey | GWNFSCHQBYIGDO-BNSMALCHSA-N |
| XLogP | 2.18 |
| TPSA | 120.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|