C23H29N5O6 — CID 18518068
3-[[2-[6-[(4-methyl-2-pyridinyl)amino]hexanoylamino]acetyl]amino]-3-(3-nitrophenyl)propanoic acid (PubChem CID 18518068) has the molecular formula C23H29N5O6 and a molecular weight of 471.51 g/mol. Its IUPAC name is 3-[[2-[6-[(4-methyl-2-pyridinyl)amino]hexanoylamino]acetyl]amino]-3-(3-nitrophenyl)propanoic acid.
| Compound Name | 3-[[2-[6-[(4-methyl-2-pyridinyl)amino]hexanoylamino]acetyl]amino]-3-(3-nitrophenyl)propanoic acid |
|---|---|
| PubChem CID | 18518068 |
| Molecular Formula | C23H29N5O6 |
| Molecular Weight | 471.51 g/mol |
| Exact Mass | 471.21 |
| IUPAC Name | 3-[[2-[6-[(4-methyl-2-pyridinyl)amino]hexanoylamino]acetyl]amino]-3-(3-nitrophenyl)propanoic acid |
| SMILES | Cc1ccnc(NCCCCCC(=O)NCC(=O)NC(CC(=O)O)c2cccc([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C23H29N5O6/c1-16-9-11-25-20(12-16)24-10-4-2-3-8-21(29)26-15-22(30)27-19(14-23(31)32)17-6-5-7-18(13-17)28(33)34/h5-7,9,11-13,19H,2-4,8,10,14-15H2,1H3,(H,24,25)(H,26,29)(H,27,30)(H,31,32) |
| InChIKey | DUNYJPKEMTVJRV-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 163.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.51 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|