C22H24F3N4NaO5 — CID 139931985
sodium 3-[[2-[4-[(4-methyl-2-pyridinyl)amino]butanoylamino]acetyl]amino]-3-[3-(trifluoromethoxy)phenyl]propanoate (PubChem CID 139931985) has the molecular formula C22H24F3N4NaO5 and a molecular weight of 504.44 g/mol. Its IUPAC name is sodium 3-[[2-[4-[(4-methyl-2-pyridinyl)amino]butanoylamino]acetyl]amino]-3-[3-(trifluoromethoxy)phenyl]propanoate.
| Compound Name | sodium 3-[[2-[4-[(4-methyl-2-pyridinyl)amino]butanoylamino]acetyl]amino]-3-[3-(trifluoromethoxy)phenyl]propanoate |
|---|---|
| PubChem CID | 139931985 |
| Molecular Formula | C22H24F3N4NaO5 |
| Molecular Weight | 504.44 g/mol |
| Exact Mass | 504.16 |
| IUPAC Name | sodium 3-[[2-[4-[(4-methyl-2-pyridinyl)amino]butanoylamino]acetyl]amino]-3-[3-(trifluoromethoxy)phenyl]propanoate |
| SMILES | Cc1ccnc(NCCCC(=O)NCC(=O)NC(CC(=O)[O-])c2cccc(OC(F)(F)F)c2)c1.[Na+] |
| InChI | InChI=1S/C22H25F3N4O5.Na/c1-14-7-9-27-18(10-14)26-8-3-6-19(30)28-13-20(31)29-17(12-21(32)33)15-4-2-5-16(11-15)34-22(23,24)25;/h2,4-5,7,9-11,17H,3,6,8,12-13H2,1H3,(H,26,27)(H,28,30)(H,29,31)(H,32,33);/q;+1/p-1 |
| InChIKey | ZYKIJKKNGYNQTG-UHFFFAOYSA-M |
| XLogP | -1.40 |
| TPSA | 132.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.44 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|