C22H28N5NaO6 — CID 173243725
sodium;hydride;3-(4-methyl-3-nitrophenyl)-3-[[2-[4-[(4-methyl-2-pyridinyl)amino]butanoylamino]acetyl]amino]propanoic acid (PubChem CID 173243725) has the molecular formula C22H28N5NaO6 and a molecular weight of 481.49 g/mol. Its IUPAC name is sodium;hydride;3-(4-methyl-3-nitrophenyl)-3-[[2-[4-[(4-methyl-2-pyridinyl)amino]butanoylamino]acetyl]amino]propanoic acid.
| Compound Name | sodium;hydride;3-(4-methyl-3-nitrophenyl)-3-[[2-[4-[(4-methyl-2-pyridinyl)amino]butanoylamino]acetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 173243725 |
| Molecular Formula | C22H28N5NaO6 |
| Molecular Weight | 481.49 g/mol |
| Exact Mass | 481.19 |
| IUPAC Name | sodium;hydride;3-(4-methyl-3-nitrophenyl)-3-[[2-[4-[(4-methyl-2-pyridinyl)amino]butanoylamino]acetyl]amino]propanoic acid |
| SMILES | Cc1ccnc(NCCCC(=O)NCC(=O)NC(CC(=O)O)c2ccc(C)c([N+](=O)[O-])c2)c1.[H-].[Na+] |
| InChI | InChI=1S/C22H27N5O6.Na.H/c1-14-7-9-24-19(10-14)23-8-3-4-20(28)25-13-21(29)26-17(12-22(30)31)16-6-5-15(2)18(11-16)27(32)33;;/h5-7,9-11,17H,3-4,8,12-13H2,1-2H3,(H,23,24)(H,25,28)(H,26,29)(H,30,31);;/q;+1;-1 |
| InChIKey | GKBZLSULTUNIOQ-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 163.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.49 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|