C24H28F3N5O8 — CID 70013074
3-(4-methyl-3-nitrophenyl)-3-[[2-[5-(pyridin-2-ylamino)pentanoylamino]acetyl]amino]propanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 70013074) has the molecular formula C24H28F3N5O8 and a molecular weight of 571.51 g/mol. Its IUPAC name is 3-(4-methyl-3-nitrophenyl)-3-[[2-[5-(pyridin-2-ylamino)pentanoylamino]acetyl]amino]propanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 3-(4-methyl-3-nitrophenyl)-3-[[2-[5-(pyridin-2-ylamino)pentanoylamino]acetyl]amino]propanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 70013074 |
| Molecular Formula | C24H28F3N5O8 |
| Molecular Weight | 571.51 g/mol |
| Exact Mass | 571.19 |
| IUPAC Name | 3-(4-methyl-3-nitrophenyl)-3-[[2-[5-(pyridin-2-ylamino)pentanoylamino]acetyl]amino]propanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | Cc1ccc(C(CC(=O)O)NC(=O)CNC(=O)CCCCNc2ccccn2)cc1[N+](=O)[O-].O=C(O)C(F)(F)F |
| InChI | InChI=1S/C22H27N5O6.C2HF3O2/c1-15-8-9-16(12-18(15)27(32)33)17(13-22(30)31)26-21(29)14-25-20(28)7-3-5-11-24-19-6-2-4-10-23-19;3-2(4,5)1(6)7/h2,4,6,8-10,12,17H,3,5,7,11,13-14H2,1H3,(H,23,24)(H,25,28)(H,26,29)(H,30,31);(H,6,7) |
| InChIKey | HQYCPQZFRARMAO-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 200.86 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.51 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|