C27H28ClFN4NaO4 — CID 70011853
CID 70011853 (PubChem CID 70011853) has the molecular formula C27H28ClFN4NaO4 and a molecular weight of 549.99 g/mol.
| Compound Name | CID 70011853 |
|---|---|
| PubChem CID | 70011853 |
| Molecular Formula | C27H28ClFN4NaO4 |
| Molecular Weight | 549.99 g/mol |
| Exact Mass | 549.17 |
| IUPAC Name | — |
| SMILES | O=C(O)CC(NC(=O)CNC(=O)CCCCNc1ccccn1)c1ccc(-c2ccc(F)c(Cl)c2)cc1.[Na] |
| InChI | InChI=1S/C27H28ClFN4O4.Na/c28-21-15-20(11-12-22(21)29)18-7-9-19(10-8-18)23(16-27(36)37)33-26(35)17-32-25(34)6-2-4-14-31-24-5-1-3-13-30-24;/h1,3,5,7-13,15,23H,2,4,6,14,16-17H2,(H,30,31)(H,32,34)(H,33,35)(H,36,37); |
| InChIKey | NTWMBRLGDGRNGR-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 120.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.99 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|