C28H31FN4O4 — CID 18518073
methyl 3-[4-(2-fluorophenyl)phenyl]-3-[[2-[5-(pyridin-2-ylamino)pentanoylamino]acetyl]amino]propanoate (PubChem CID 18518073) has the molecular formula C28H31FN4O4 and a molecular weight of 506.58 g/mol. Its IUPAC name is methyl 3-[4-(2-fluorophenyl)phenyl]-3-[[2-[5-(pyridin-2-ylamino)pentanoylamino]acetyl]amino]propanoate.
| Compound Name | methyl 3-[4-(2-fluorophenyl)phenyl]-3-[[2-[5-(pyridin-2-ylamino)pentanoylamino]acetyl]amino]propanoate |
|---|---|
| PubChem CID | 18518073 |
| Molecular Formula | C28H31FN4O4 |
| Molecular Weight | 506.58 g/mol |
| Exact Mass | 506.23 |
| IUPAC Name | methyl 3-[4-(2-fluorophenyl)phenyl]-3-[[2-[5-(pyridin-2-ylamino)pentanoylamino]acetyl]amino]propanoate |
| SMILES | COC(=O)CC(NC(=O)CNC(=O)CCCCNc1ccccn1)c1ccc(-c2ccccc2F)cc1 |
| InChI | InChI=1S/C28H31FN4O4/c1-37-28(36)18-24(21-14-12-20(13-15-21)22-8-2-3-9-23(22)29)33-27(35)19-32-26(34)11-5-7-17-31-25-10-4-6-16-30-25/h2-4,6,8-10,12-16,24H,5,7,11,17-19H2,1H3,(H,30,31)(H,32,34)(H,33,35) |
| InChIKey | JLXPUHFLGCOPAV-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 109.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.58 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|