C44H50ClN7O7 — CID 159855902
methyl 3-[(2-aminoacetyl)amino]-3-(4-phenylphenyl)propanoate;methyl 3-(4-phenylphenyl)-3-[[2-[4-(pyrimidin-2-ylamino)butanoylamino]acetyl]amino]propanoate;hydrochloride (PubChem CID 159855902) has the molecular formula C44H50ClN7O7 and a molecular weight of 824.38 g/mol. Its IUPAC name is methyl 3-[(2-aminoacetyl)amino]-3-(4-phenylphenyl)propanoate;methyl 3-(4-phenylphenyl)-3-[[2-[4-(pyrimidin-2-ylamino)butanoylamino]acetyl]amino]propanoate;hydrochloride.
| Compound Name | methyl 3-[(2-aminoacetyl)amino]-3-(4-phenylphenyl)propanoate;methyl 3-(4-phenylphenyl)-3-[[2-[4-(pyrimidin-2-ylamino)butanoylamino]acetyl]amino]propanoate;hydrochloride |
|---|---|
| PubChem CID | 159855902 |
| Molecular Formula | C44H50ClN7O7 |
| Molecular Weight | 824.38 g/mol |
| Exact Mass | 823.35 |
| IUPAC Name | methyl 3-[(2-aminoacetyl)amino]-3-(4-phenylphenyl)propanoate;methyl 3-(4-phenylphenyl)-3-[[2-[4-(pyrimidin-2-ylamino)butanoylamino]acetyl]amino]propanoate;hydrochloride |
| SMILES | COC(=O)CC(NC(=O)CN)c1ccc(-c2ccccc2)cc1.COC(=O)CC(NC(=O)CNC(=O)CCCNc1ncccn1)c1ccc(-c2ccccc2)cc1.Cl |
| InChI | InChI=1S/C26H29N5O4.C18H20N2O3.ClH/c1-35-25(34)17-22(21-12-10-20(11-13-21)19-7-3-2-4-8-19)31-24(33)18-30-23(32)9-5-14-27-26-28-15-6-16-29-26;1-23-18(22)11-16(20-17(21)12-19)15-9-7-14(8-10-15)13-5-3-2-4-6-13;/h2-4,6-8,10-13,15-16,22H,5,9,14,17-18H2,1H3,(H,30,32)(H,31,33)(H,27,28,29);2-10,16H,11-12,19H2,1H3,(H,20,21);1H |
| InChIKey | NQNGVVTXOGVJIH-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 203.73 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 824.38 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|