C32H39N5O4 — CID 142101398
ethane;ethyl 3-[4-(1H-indol-7-yl)phenyl]-3-[[2-[4-(pyridin-2-ylamino)butanoylamino]acetyl]amino]propanoate (PubChem CID 142101398) has the molecular formula C32H39N5O4 and a molecular weight of 557.70 g/mol. Its IUPAC name is ethane;ethyl 3-[4-(1H-indol-7-yl)phenyl]-3-[[2-[4-(pyridin-2-ylamino)butanoylamino]acetyl]amino]propanoate.
| Compound Name | ethane;ethyl 3-[4-(1H-indol-7-yl)phenyl]-3-[[2-[4-(pyridin-2-ylamino)butanoylamino]acetyl]amino]propanoate |
|---|---|
| PubChem CID | 142101398 |
| Molecular Formula | C32H39N5O4 |
| Molecular Weight | 557.70 g/mol |
| Exact Mass | 557.30 |
| IUPAC Name | ethane;ethyl 3-[4-(1H-indol-7-yl)phenyl]-3-[[2-[4-(pyridin-2-ylamino)butanoylamino]acetyl]amino]propanoate |
| SMILES | CC.CCOC(=O)CC(NC(=O)CNC(=O)CCCNc1ccccn1)c1ccc(-c2cccc3cc[nH]c23)cc1 |
| InChI | InChI=1S/C30H33N5O4.C2H6/c1-2-39-29(38)19-25(22-13-11-21(12-14-22)24-8-5-7-23-15-18-33-30(23)24)35-28(37)20-34-27(36)10-6-17-32-26-9-3-4-16-31-26;1-2/h3-5,7-9,11-16,18,25,33H,2,6,10,17,19-20H2,1H3,(H,31,32)(H,34,36)(H,35,37);1-2H3 |
| InChIKey | GAMIYLRZIHFGBF-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 125.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.70 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|