C21H24ClN5O6 — CID 18518130
methyl 3-(4-chloro-3-nitrophenyl)-3-[[2-[4-(pyridin-2-ylamino)butanoylamino]acetyl]amino]propanoate (PubChem CID 18518130) has the molecular formula C21H24ClN5O6 and a molecular weight of 477.91 g/mol. Its IUPAC name is methyl 3-(4-chloro-3-nitrophenyl)-3-[[2-[4-(pyridin-2-ylamino)butanoylamino]acetyl]amino]propanoate.
| Compound Name | methyl 3-(4-chloro-3-nitrophenyl)-3-[[2-[4-(pyridin-2-ylamino)butanoylamino]acetyl]amino]propanoate |
|---|---|
| PubChem CID | 18518130 |
| Molecular Formula | C21H24ClN5O6 |
| Molecular Weight | 477.91 g/mol |
| Exact Mass | 477.14 |
| IUPAC Name | methyl 3-(4-chloro-3-nitrophenyl)-3-[[2-[4-(pyridin-2-ylamino)butanoylamino]acetyl]amino]propanoate |
| SMILES | COC(=O)CC(NC(=O)CNC(=O)CCCNc1ccccn1)c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H24ClN5O6/c1-33-21(30)12-16(14-7-8-15(22)17(11-14)27(31)32)26-20(29)13-25-19(28)6-4-10-24-18-5-2-3-9-23-18/h2-3,5,7-9,11,16H,4,6,10,12-13H2,1H3,(H,23,24)(H,25,28)(H,26,29) |
| InChIKey | NAKBEDAIUPNVSI-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 152.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.91 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|