C21H24N5NaO6 — CID 70010998
sodium 3-[[2-[4-[(4-methyl-2-pyridinyl)amino]butanoylamino]acetyl]amino]-3-(4-nitrophenyl)propanoate (PubChem CID 70010998) has the molecular formula C21H24N5NaO6 and a molecular weight of 465.44 g/mol. Its IUPAC name is sodium 3-[[2-[4-[(4-methyl-2-pyridinyl)amino]butanoylamino]acetyl]amino]-3-(4-nitrophenyl)propanoate.
| Compound Name | sodium 3-[[2-[4-[(4-methyl-2-pyridinyl)amino]butanoylamino]acetyl]amino]-3-(4-nitrophenyl)propanoate |
|---|---|
| PubChem CID | 70010998 |
| Molecular Formula | C21H24N5NaO6 |
| Molecular Weight | 465.44 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | sodium 3-[[2-[4-[(4-methyl-2-pyridinyl)amino]butanoylamino]acetyl]amino]-3-(4-nitrophenyl)propanoate |
| SMILES | Cc1ccnc(NCCCC(=O)NCC(=O)NC(CC(=O)[O-])c2ccc([N+](=O)[O-])cc2)c1.[Na+] |
| InChI | InChI=1S/C21H25N5O6.Na/c1-14-8-10-23-18(11-14)22-9-2-3-19(27)24-13-20(28)25-17(12-21(29)30)15-4-6-16(7-5-15)26(31)32;/h4-8,10-11,17H,2-3,9,12-13H2,1H3,(H,22,23)(H,24,27)(H,25,28)(H,29,30);/q;+1/p-1 |
| InChIKey | CRNVQEOJZNSJBY-UHFFFAOYSA-M |
| XLogP | -2.39 |
| TPSA | 166.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.44 |
| LogP ≤ 5 | -2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|