C44H58N4O8 — CID 155331015
(3R)-3-[[(2S)-4-[2-[2-[2-(3-methylbutoxy)ethoxy]ethoxy]ethoxy]-2-[4-[(4-methyl-2-pyridinyl)amino]butanoylamino]butanoyl]amino]-3-(4-naphthalen-1-ylphenyl)propanoic acid (PubChem CID 155331015) has the molecular formula C44H58N4O8 and a molecular weight of 770.97 g/mol. Its IUPAC name is (3R)-3-[[(2S)-4-[2-[2-[2-(3-methylbutoxy)ethoxy]ethoxy]ethoxy]-2-[4-[(4-methyl-2-pyridinyl)amino]butanoylamino]butanoyl]amino]-3-(4-naphthalen-1-ylphenyl)propanoic acid.
| Compound Name | (3R)-3-[[(2S)-4-[2-[2-[2-(3-methylbutoxy)ethoxy]ethoxy]ethoxy]-2-[4-[(4-methyl-2-pyridinyl)amino]butanoylamino]butanoyl]amino]-3-(4-naphthalen-1-ylphenyl)propanoic acid |
|---|---|
| PubChem CID | 155331015 |
| Molecular Formula | C44H58N4O8 |
| Molecular Weight | 770.97 g/mol |
| Exact Mass | 770.43 |
| IUPAC Name | (3R)-3-[[(2S)-4-[2-[2-[2-(3-methylbutoxy)ethoxy]ethoxy]ethoxy]-2-[4-[(4-methyl-2-pyridinyl)amino]butanoylamino]butanoyl]amino]-3-(4-naphthalen-1-ylphenyl)propanoic acid |
| SMILES | Cc1ccnc(NCCCC(=O)N[C@@H](CCOCCOCCOCCOCCC(C)C)C(=O)N[C@H](CC(=O)O)c2ccc(-c3cccc4ccccc34)cc2)c1 |
| InChI | InChI=1S/C44H58N4O8/c1-32(2)18-22-53-24-26-55-28-29-56-27-25-54-23-19-39(47-42(49)12-7-20-45-41-30-33(3)17-21-46-41)44(52)48-40(31-43(50)51)36-15-13-35(14-16-36)38-11-6-9-34-8-4-5-10-37(34)38/h4-6,8-11,13-17,21,30,32,39-40H,7,12,18-20,22-29,31H2,1-3H3,(H,45,46)(H,47,49)(H,48,52)(H,50,51)/t39-,40+/m0/s1 |
| InChIKey | WXTHRPMMBBIGND-IOLBBIBUSA-N |
| XLogP | 6.72 |
| TPSA | 157.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.97 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|