C35H44N4O4 — CID 162756958
ethane;N-ethyl-4-[(4-methyl-2-pyridinyl)amino]butanamide;(3S)-3-formamido-3-[4-(4-methylnaphthalen-1-yl)phenyl]propanoic acid (PubChem CID 162756958) has the molecular formula C35H44N4O4 and a molecular weight of 584.76 g/mol. Its IUPAC name is ethane;N-ethyl-4-[(4-methyl-2-pyridinyl)amino]butanamide;(3S)-3-formamido-3-[4-(4-methylnaphthalen-1-yl)phenyl]propanoic acid.
| Compound Name | ethane;N-ethyl-4-[(4-methyl-2-pyridinyl)amino]butanamide;(3S)-3-formamido-3-[4-(4-methylnaphthalen-1-yl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 162756958 |
| Molecular Formula | C35H44N4O4 |
| Molecular Weight | 584.76 g/mol |
| Exact Mass | 584.34 |
| IUPAC Name | ethane;N-ethyl-4-[(4-methyl-2-pyridinyl)amino]butanamide;(3S)-3-formamido-3-[4-(4-methylnaphthalen-1-yl)phenyl]propanoic acid |
| SMILES | CC.CCNC(=O)CCCNc1cc(C)ccn1.Cc1ccc(-c2ccc([C@H](CC(=O)O)NC=O)cc2)c2ccccc12 |
| InChI | InChI=1S/C21H19NO3.C12H19N3O.C2H6/c1-14-6-11-18(19-5-3-2-4-17(14)19)15-7-9-16(10-8-15)20(22-13-23)12-21(24)25;1-3-13-12(16)5-4-7-14-11-9-10(2)6-8-15-11;1-2/h2-11,13,20H,12H2,1H3,(H,22,23)(H,24,25);6,8-9H,3-5,7H2,1-2H3,(H,13,16)(H,14,15);1-2H3/t20-;;/m0../s1 |
| InChIKey | FNKKCFSIEXRKDS-FJSYBICCSA-N |
| XLogP | 6.82 |
| TPSA | 120.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.76 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|