C10H14N2O3 — CID 55211793
methyl 3-hydroxy-2-[(3-methyl-2-pyridinyl)amino]propanoate (PubChem CID 55211793) has the molecular formula C10H14N2O3 and a molecular weight of 210.23 g/mol. Its IUPAC name is methyl 3-hydroxy-2-[(3-methyl-2-pyridinyl)amino]propanoate.
| Compound Name | methyl 3-hydroxy-2-[(3-methyl-2-pyridinyl)amino]propanoate |
|---|---|
| PubChem CID | 55211793 |
| Molecular Formula | C10H14N2O3 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | methyl 3-hydroxy-2-[(3-methyl-2-pyridinyl)amino]propanoate |
| SMILES | COC(=O)C(CO)Nc1ncccc1C |
| InChI | InChI=1S/C10H14N2O3/c1-7-4-3-5-11-9(7)12-8(6-13)10(14)15-2/h3-5,8,13H,6H2,1-2H3,(H,11,12) |
| InChIKey | AZYBWMWNNJPXAH-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |