About 2-(pyridin-2-ylamino)propanoic acid;hydrate;dihydrochloride
2-(pyridin-2-ylamino)propanoic acid;hydrate;dihydrochloride (PubChem CID 70348749) has the molecular formula C8H14Cl2N2O3
and a molecular weight of 257.12 g/mol. Its IUPAC name is 2-(pyridin-2-ylamino)propanoic acid;hydrate;dihydrochloride.
Molecular Properties
| Compound Name | 2-(pyridin-2-ylamino)propanoic acid;hydrate;dihydrochloride |
| PubChem CID | 70348749 |
| Molecular Formula | C8H14Cl2N2O3 |
| Molecular Weight | 257.12 g/mol |
| Exact Mass | 256.04 |
| IUPAC Name | 2-(pyridin-2-ylamino)propanoic acid;hydrate;dihydrochloride |
| SMILES | CC(Nc1ccccn1)C(=O)O.Cl.Cl.O |
| InChI | InChI=1S/C8H10N2O2.2ClH.H2O/c1-6(8(11)12)10-7-4-2-3-5-9-7;;;/h2-6H,1H3,(H,9,10)(H,11,12);2*1H;1H2 |
| InChIKey | AGOSCACCMUQODZ-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 93.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.12 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(pyridin-2-ylamino)propanoic acid;hydrate;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(pyridin-2-ylamino)propanoic acid;hydrate;dihydrochloride?
The IUPAC name of 2-(pyridin-2-ylamino)propanoic acid;hydrate;dihydrochloride (CID 70348749) is 2-(pyridin-2-ylamino)propanoic acid;hydrate;dihydrochloride.
What is the SMILES notation for 2-(pyridin-2-ylamino)propanoic acid;hydrate;dihydrochloride?
The canonical SMILES for 2-(pyridin-2-ylamino)propanoic acid;hydrate;dihydrochloride is CC(Nc1ccccn1)C(=O)O.Cl.Cl.O.
What is the InChIKey of 2-(pyridin-2-ylamino)propanoic acid;hydrate;dihydrochloride?
The InChIKey is AGOSCACCMUQODZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O2.2ClH.H2O/c1-6(8(11)12)10-7-4-2-3-5-9-7;;;/h2-6H,1H3,(H,9,10)(H,11,12);2*1H;1H2.
What are the key properties of 2-(pyridin-2-ylamino)propanoic acid;hydrate;dihydrochloride?
2-(pyridin-2-ylamino)propanoic acid;hydrate;dihydrochloride has a molecular weight of 257.12 g/mol, XLogP of 0.99, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(pyridin-2-ylamino)propanoic acid;hydrate;dihydrochloride is sourced from PubChem (CID 70348749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).