C19H23N3O4S — CID 174859044
2-aminopropanoic acid;1-benzothiophene;2-(pyridin-2-ylamino)propanoic acid (PubChem CID 174859044) has the molecular formula C19H23N3O4S and a molecular weight of 389.48 g/mol. Its IUPAC name is 2-aminopropanoic acid;1-benzothiophene;2-(pyridin-2-ylamino)propanoic acid.
| Compound Name | 2-aminopropanoic acid;1-benzothiophene;2-(pyridin-2-ylamino)propanoic acid |
|---|---|
| PubChem CID | 174859044 |
| Molecular Formula | C19H23N3O4S |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | 2-aminopropanoic acid;1-benzothiophene;2-(pyridin-2-ylamino)propanoic acid |
| SMILES | CC(N)C(=O)O.CC(Nc1ccccn1)C(=O)O.c1ccc2sccc2c1 |
| InChI | InChI=1S/C8H10N2O2.C8H6S.C3H7NO2/c1-6(8(11)12)10-7-4-2-3-5-9-7;1-2-4-8-7(3-1)5-6-9-8;1-2(4)3(5)6/h2-6H,1H3,(H,9,10)(H,11,12);1-6H;2H,4H2,1H3,(H,5,6) |
| InChIKey | PYADLDJJFJHOKY-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 125.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |