About 1-benzothiophene;propan-2-amine
1-benzothiophene;propan-2-amine (PubChem CID 67916286) has the molecular formula C11H15NS
and a molecular weight of 193.32 g/mol. Its IUPAC name is 1-benzothiophene;propan-2-amine.
Molecular Properties
| Compound Name | 1-benzothiophene;propan-2-amine |
| PubChem CID | 67916286 |
| Molecular Formula | C11H15NS |
| Molecular Weight | 193.32 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | 1-benzothiophene;propan-2-amine |
| SMILES | CC(C)N.c1ccc2sccc2c1 |
| InChI | InChI=1S/C8H6S.C3H9N/c1-2-4-8-7(3-1)5-6-9-8;1-3(2)4/h1-6H;3H,4H2,1-2H3 |
| InChIKey | IGZRUMSQEHGNML-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.32 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-benzothiophene;propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzothiophene;propan-2-amine?
The IUPAC name of 1-benzothiophene;propan-2-amine (CID 67916286) is 1-benzothiophene;propan-2-amine.
What is the SMILES notation for 1-benzothiophene;propan-2-amine?
The canonical SMILES for 1-benzothiophene;propan-2-amine is CC(C)N.c1ccc2sccc2c1.
What is the InChIKey of 1-benzothiophene;propan-2-amine?
The InChIKey is IGZRUMSQEHGNML-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6S.C3H9N/c1-2-4-8-7(3-1)5-6-9-8;1-3(2)4/h1-6H;3H,4H2,1-2H3.
What are the key properties of 1-benzothiophene;propan-2-amine?
1-benzothiophene;propan-2-amine has a molecular weight of 193.32 g/mol, XLogP of 3.25, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzothiophene;propan-2-amine is sourced from PubChem (CID 67916286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).