About 1-benzothiophene;cyclopenta-1,3-diene
1-benzothiophene;cyclopenta-1,3-diene (PubChem CID 145348127) has the molecular formula C13H12S
and a molecular weight of 200.31 g/mol. Its IUPAC name is 1-benzothiophene;cyclopenta-1,3-diene.
Molecular Properties
| Compound Name | 1-benzothiophene;cyclopenta-1,3-diene |
| PubChem CID | 145348127 |
| Molecular Formula | C13H12S |
| Molecular Weight | 200.31 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | 1-benzothiophene;cyclopenta-1,3-diene |
| SMILES | C1=CCC=C1.c1ccc2sccc2c1 |
| InChI | InChI=1S/C8H6S.C5H6/c1-2-4-8-7(3-1)5-6-9-8;1-2-4-5-3-1/h1-6H;1-4H,5H2 |
| InChIKey | YEDBWTZKYPMXPB-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.31 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-benzothiophene;cyclopenta-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzothiophene;cyclopenta-1,3-diene?
The IUPAC name of 1-benzothiophene;cyclopenta-1,3-diene (CID 145348127) is 1-benzothiophene;cyclopenta-1,3-diene.
What is the SMILES notation for 1-benzothiophene;cyclopenta-1,3-diene?
The canonical SMILES for 1-benzothiophene;cyclopenta-1,3-diene is C1=CCC=C1.c1ccc2sccc2c1.
What is the InChIKey of 1-benzothiophene;cyclopenta-1,3-diene?
The InChIKey is YEDBWTZKYPMXPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6S.C5H6/c1-2-4-8-7(3-1)5-6-9-8;1-2-4-5-3-1/h1-6H;1-4H,5H2.
What are the key properties of 1-benzothiophene;cyclopenta-1,3-diene?
1-benzothiophene;cyclopenta-1,3-diene has a molecular weight of 200.31 g/mol, XLogP of 4.40, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzothiophene;cyclopenta-1,3-diene is sourced from PubChem (CID 145348127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).