C18H12S3 — CID 158748847
1-benzothiophene;thieno[2,3-e][1]benzothiole (PubChem CID 158748847) has the molecular formula C18H12S3 and a molecular weight of 324.50 g/mol. Its IUPAC name is 1-benzothiophene;thieno[2,3-e][1]benzothiole.
| Compound Name | 1-benzothiophene;thieno[2,3-e][1]benzothiole |
|---|---|
| PubChem CID | 158748847 |
| Molecular Formula | C18H12S3 |
| Molecular Weight | 324.50 g/mol |
| Exact Mass | 324.01 |
| IUPAC Name | 1-benzothiophene;thieno[2,3-e][1]benzothiole |
| SMILES | c1cc2c(ccc3ccsc32)s1.c1ccc2sccc2c1 |
| InChI | InChI=1S/C10H6S2.C8H6S/c1-2-9-8(4-6-11-9)10-7(1)3-5-12-10;1-2-4-8-7(3-1)5-6-9-8/h1-6H;1-6H |
| InChIKey | INFFWSIRRYDJJX-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.50 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |