C10H6S2 — CID 605457
thieno[3,2-b][1]benzothiole (PubChem CID 605457) has the molecular formula C10H6S2 and a molecular weight of 190.29 g/mol. Its IUPAC name is thieno[3,2-b][1]benzothiole.
| Compound Name | thieno[3,2-b][1]benzothiole |
|---|---|
| PubChem CID | 605457 |
| Molecular Formula | C10H6S2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 189.99 |
| IUPAC Name | thieno[3,2-b][1]benzothiole |
| SMILES | c1ccc2c(c1)sc1ccsc12 |
| InChI | InChI=1S/C10H6S2/c1-2-4-8-7(3-1)10-9(12-8)5-6-11-10/h1-6H |
| InChIKey | OFPPMFSHIKARPG-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |