C12H7NS2 — CID 163979264
11,15-dithia-8-azatetracyclo[7.6.0.02,7.010,14]pentadeca-1(9),2,4,6,10(14),12-hexaene (PubChem CID 163979264) has the molecular formula C12H7NS2 and a molecular weight of 229.33 g/mol. Its IUPAC name is 11,15-dithia-8-azatetracyclo[7.6.0.02,7.010,14]pentadeca-1(9),2,4,6,10(14),12-hexaene.
| Compound Name | 11,15-dithia-8-azatetracyclo[7.6.0.02,7.010,14]pentadeca-1(9),2,4,6,10(14),12-hexaene |
|---|---|
| PubChem CID | 163979264 |
| Molecular Formula | C12H7NS2 |
| Molecular Weight | 229.33 g/mol |
| Exact Mass | 229.00 |
| IUPAC Name | 11,15-dithia-8-azatetracyclo[7.6.0.02,7.010,14]pentadeca-1(9),2,4,6,10(14),12-hexaene |
| SMILES | c1ccc2c(c1)[nH]c1c3sccc3sc21 |
| InChI | InChI=1S/C12H7NS2/c1-2-4-8-7(3-1)11-10(13-8)12-9(15-11)5-6-14-12/h1-6,13H |
| InChIKey | SWYCXQDTOZNUEC-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.33 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |