5,10-dihydroindolo[3,2-b]indole;molecular hydrogen

C14H14N2 — CID 145382713

IUPAC5,10-dihydroindolo[3,2-b]indole;molecular hydrogen
SMILES[H][H].[H][H].c1ccc2c(c1)[nH]c1c3ccccc3[nH]c21
InChIInChI=1S/C14H10N2.2H2/c1-3-7-11-9(5-1)13-14(15-11)10-6-2-4-8-12(10)16-13;;/h1-8,15-16H;2*1H
InChIKeyRWHWAYNSJDWHPB-UHFFFAOYSA-N
MW210.28 g/mol
LogP4.29
Rot. Bonds

About 5,10-dihydroindolo[3,2-b]indole;molecular hydrogen

5,10-dihydroindolo[3,2-b]indole;molecular hydrogen (PubChem CID 145382713) has the molecular formula C14H14N2 and a molecular weight of 210.28 g/mol. Its IUPAC name is 5,10-dihydroindolo[3,2-b]indole;molecular hydrogen.

Molecular Properties

Compound Name5,10-dihydroindolo[3,2-b]indole;molecular hydrogen
PubChem CID145382713
Molecular FormulaC14H14N2
Molecular Weight210.28 g/mol
Exact Mass210.12
IUPAC Name5,10-dihydroindolo[3,2-b]indole;molecular hydrogen
SMILES[H][H].[H][H].c1ccc2c(c1)[nH]c1c3ccccc3[nH]c21
InChIInChI=1S/C14H10N2.2H2/c1-3-7-11-9(5-1)13-14(15-11)10-6-2-4-8-12(10)16-13;;/h1-8,15-16H;2*1H
InChIKeyRWHWAYNSJDWHPB-UHFFFAOYSA-N
XLogP4.29
TPSA31.58 Ų
H-Bond Donors2
H-Bond Acceptors
Rotatable Bonds
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500210.28
LogP ≤ 54.29
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 100

Analyze 5,10-dihydroindolo[3,2-b]indole;molecular hydrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5,10-dihydroindolo[3,2-b]indole;molecular hydrogen?
The IUPAC name of 5,10-dihydroindolo[3,2-b]indole;molecular hydrogen (CID 145382713) is 5,10-dihydroindolo[3,2-b]indole;molecular hydrogen.
What is the SMILES notation for 5,10-dihydroindolo[3,2-b]indole;molecular hydrogen?
The canonical SMILES for 5,10-dihydroindolo[3,2-b]indole;molecular hydrogen is [H][H].[H][H].c1ccc2c(c1)[nH]c1c3ccccc3[nH]c21.
What is the InChIKey of 5,10-dihydroindolo[3,2-b]indole;molecular hydrogen?
The InChIKey is RWHWAYNSJDWHPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10N2.2H2/c1-3-7-11-9(5-1)13-14(15-11)10-6-2-4-8-12(10)16-13;;/h1-8,15-16H;2*1H.
What are the key properties of 5,10-dihydroindolo[3,2-b]indole;molecular hydrogen?
5,10-dihydroindolo[3,2-b]indole;molecular hydrogen has a molecular weight of 210.28 g/mol, XLogP of 4.29, 0 rotatable bonds, 2 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5,10-dihydroindolo[3,2-b]indole;molecular hydrogen is sourced from PubChem (CID 145382713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).