About bis(9H-carbazole);platinum(2+)
bis(9H-carbazole);platinum(2+) (PubChem CID 175826437) has the molecular formula C24H18N2Pt+2
and a molecular weight of 529.50 g/mol. Its IUPAC name is bis(9H-carbazole);platinum(2+).
Molecular Properties
| Compound Name | bis(9H-carbazole);platinum(2+) |
| PubChem CID | 175826437 |
| Molecular Formula | C24H18N2Pt+2 |
| Molecular Weight | 529.50 g/mol |
| Exact Mass | 529.11 |
| IUPAC Name | bis(9H-carbazole);platinum(2+) |
| SMILES | [Pt+2].c1ccc2c(c1)[nH]c1ccccc12.c1ccc2c(c1)[nH]c1ccccc12 |
| InChI | InChI=1S/2C12H9N.Pt/c2*1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11;/h2*1-8,13H;/q;;+2 |
| InChIKey | LIXZAKDDTMXCHJ-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 31.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 529.50 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze bis(9H-carbazole);platinum(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(9H-carbazole);platinum(2+)?
The IUPAC name of bis(9H-carbazole);platinum(2+) (CID 175826437) is bis(9H-carbazole);platinum(2+).
What is the SMILES notation for bis(9H-carbazole);platinum(2+)?
The canonical SMILES for bis(9H-carbazole);platinum(2+) is [Pt+2].c1ccc2c(c1)[nH]c1ccccc12.c1ccc2c(c1)[nH]c1ccccc12.
What is the InChIKey of bis(9H-carbazole);platinum(2+)?
The InChIKey is LIXZAKDDTMXCHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C12H9N.Pt/c2*1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11;/h2*1-8,13H;/q;;+2.
What are the key properties of bis(9H-carbazole);platinum(2+)?
bis(9H-carbazole);platinum(2+) has a molecular weight of 529.50 g/mol, XLogP of 6.64, 0 rotatable bonds, 2 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bis(9H-carbazole);platinum(2+) is sourced from PubChem (CID 175826437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).